Diiodohydroxyquinoline
From Wikipedia, the free encyclopedia
| Diiodohydroxyquinoline | |
|---|---|
| IUPAC name | 5,7-diiodoquinolin-8-ol |
| Identifiers | |
| CAS number | [83-73-8] |
| PubChem | |
| MeSH | |
| SMILES | C1=CC2=C(C(=C(C=C2I)I)O)N=C1 |
| Properties | |
| Molecular formula | C9H5I2NO |
| Molar mass | 396.951 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Diiodohydroxyquinoline (INN) or iodoquinol (USAN), widely known by the trade name Diodoquin, is a quinoline derivative which can be used in the treatment of amoebiasis.
|
|||||||||||

